C19H16F3IN4OS — CID 153389321
ethane;2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-pyrrolo[3,2-b]pyridin-5-yl]ethynyl thiohypoiodite (PubChem CID 153389321) has the molecular formula C19H16F3IN4OS and a molecular weight of 532.33 g/mol. Its IUPAC name is ethane;2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-pyrrolo[3,2-b]pyridin-5-yl]ethynyl thiohypoiodite.
| Compound Name | ethane;2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-pyrrolo[3,2-b]pyridin-5-yl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 153389321 |
| Molecular Formula | C19H16F3IN4OS |
| Molecular Weight | 532.33 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | ethane;2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-pyrrolo[3,2-b]pyridin-5-yl]ethynyl thiohypoiodite |
| SMILES | CC.O=C(Nc1ccc(C(F)(F)F)cc1)Nc1c[nH]c2ccc(C#CSI)nc12 |
| InChI | InChI=1S/C17H10F3IN4OS.C2H6/c18-17(19,20)10-1-3-11(4-2-10)24-16(26)25-14-9-22-13-6-5-12(7-8-27-21)23-15(13)14;1-2/h1-6,9,22H,(H2,24,25,26);1-2H3 |
| InChIKey | DCBNNBKUOONUSW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.33 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|