C24H21F11N6O — CID 164573357
1-[5-[4-(2,2,3,3,4,4,5,5-octafluoropentyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 164573357) has the molecular formula C24H21F11N6O and a molecular weight of 618.45 g/mol. Its IUPAC name is 1-[5-[4-(2,2,3,3,4,4,5,5-octafluoropentyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[4-(2,2,3,3,4,4,5,5-octafluoropentyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 164573357 |
| Molecular Formula | C24H21F11N6O |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 1-[5-[4-(2,2,3,3,4,4,5,5-octafluoropentyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1c[nH]c2ccc(N3CCN(CC(F)(F)C(F)(F)C(F)(F)C(F)F)CC3)nc12 |
| InChI | InChI=1S/C24H21F11N6O/c25-19(26)22(29,30)24(34,35)21(27,28)12-40-7-9-41(10-8-40)17-6-5-15-18(39-17)16(11-36-15)38-20(42)37-14-3-1-13(2-4-14)23(31,32)33/h1-6,11,19,36H,7-10,12H2,(H2,37,38,42) |
| InChIKey | YEBLCMINTSYQAO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|