C14H9N3O — CID 153389436
(5-phenyl-1H-pyrrolo[2,3-c]pyridin-3-yl) cyanate (PubChem CID 153389436) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is (5-phenyl-1H-pyrrolo[2,3-c]pyridin-3-yl) cyanate.
| Compound Name | (5-phenyl-1H-pyrrolo[2,3-c]pyridin-3-yl) cyanate |
|---|---|
| PubChem CID | 153389436 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (5-phenyl-1H-pyrrolo[2,3-c]pyridin-3-yl) cyanate |
| SMILES | N#COc1c[nH]c2cnc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C14H9N3O/c15-9-18-14-8-17-13-7-16-12(6-11(13)14)10-4-2-1-3-5-10/h1-8,17H |
| InChIKey | MVFRFYGDPXOVPE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|