C17H20N2 — CID 153390409
10-(2,3-dimethylbutan-2-yl)pyrimido[1,2-a]indole (PubChem CID 153390409) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 10-(2,3-dimethylbutan-2-yl)pyrimido[1,2-a]indole.
| Compound Name | 10-(2,3-dimethylbutan-2-yl)pyrimido[1,2-a]indole |
|---|---|
| PubChem CID | 153390409 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 10-(2,3-dimethylbutan-2-yl)pyrimido[1,2-a]indole |
| SMILES | CC(C)C(C)(C)c1c2ccccc2n2cccnc12 |
| InChI | InChI=1S/C17H20N2/c1-12(2)17(3,4)15-13-8-5-6-9-14(13)19-11-7-10-18-16(15)19/h5-12H,1-4H3 |
| InChIKey | GJHUENKKPGYQJC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |