C13H13N3 — CID 177470797
7-propan-2-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 177470797) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 7-propan-2-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-propan-2-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 177470797 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 7-propan-2-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CC(C)c1nc2cccnc2n2cccc12 |
| InChI | InChI=1S/C13H13N3/c1-9(2)12-11-6-4-8-16(11)13-10(15-12)5-3-7-14-13/h3-9H,1-2H3 |
| InChIKey | BUFWBJNUKIYITJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |