C29H34F2N2O2 — CID 153391709
4-ethyl-N-[2-fluoro-5-[4-[(4-fluorophenyl)methoxy]-2-methylanilino]phenyl]heptanamide (PubChem CID 153391709) has the molecular formula C29H34F2N2O2 and a molecular weight of 480.60 g/mol. Its IUPAC name is 4-ethyl-N-[2-fluoro-5-[4-[(4-fluorophenyl)methoxy]-2-methylanilino]phenyl]heptanamide.
| Compound Name | 4-ethyl-N-[2-fluoro-5-[4-[(4-fluorophenyl)methoxy]-2-methylanilino]phenyl]heptanamide |
|---|---|
| PubChem CID | 153391709 |
| Molecular Formula | C29H34F2N2O2 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4-ethyl-N-[2-fluoro-5-[4-[(4-fluorophenyl)methoxy]-2-methylanilino]phenyl]heptanamide |
| SMILES | CCCC(CC)CCC(=O)Nc1cc(Nc2ccc(OCc3ccc(F)cc3)cc2C)ccc1F |
| InChI | InChI=1S/C29H34F2N2O2/c1-4-6-21(5-2)9-16-29(34)33-28-18-24(12-14-26(28)31)32-27-15-13-25(17-20(27)3)35-19-22-7-10-23(30)11-8-22/h7-8,10-15,17-18,21,32H,4-6,9,16,19H2,1-3H3,(H,33,34) |
| InChIKey | CVLJEZWBCLXXGS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |