C29H35FN2O2 — CID 153391618
4-ethyl-N-[2-fluoro-5-(2-methyl-4-phenylmethoxyanilino)phenyl]heptanamide (PubChem CID 153391618) has the molecular formula C29H35FN2O2 and a molecular weight of 462.61 g/mol. Its IUPAC name is 4-ethyl-N-[2-fluoro-5-(2-methyl-4-phenylmethoxyanilino)phenyl]heptanamide.
| Compound Name | 4-ethyl-N-[2-fluoro-5-(2-methyl-4-phenylmethoxyanilino)phenyl]heptanamide |
|---|---|
| PubChem CID | 153391618 |
| Molecular Formula | C29H35FN2O2 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 4-ethyl-N-[2-fluoro-5-(2-methyl-4-phenylmethoxyanilino)phenyl]heptanamide |
| SMILES | CCCC(CC)CCC(=O)Nc1cc(Nc2ccc(OCc3ccccc3)cc2C)ccc1F |
| InChI | InChI=1S/C29H35FN2O2/c1-4-9-22(5-2)12-17-29(33)32-28-19-24(13-15-26(28)30)31-27-16-14-25(18-21(27)3)34-20-23-10-7-6-8-11-23/h6-8,10-11,13-16,18-19,22,31H,4-5,9,12,17,20H2,1-3H3,(H,32,33) |
| InChIKey | NZMQQNDZOUQABT-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |