C32H42N2O3 — CID 153391706
2-(3-ethylhexylamino)-2-[3-(4-phenylmethoxy-2-propan-2-ylanilino)phenyl]acetic acid (PubChem CID 153391706) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is 2-(3-ethylhexylamino)-2-[3-(4-phenylmethoxy-2-propan-2-ylanilino)phenyl]acetic acid.
| Compound Name | 2-(3-ethylhexylamino)-2-[3-(4-phenylmethoxy-2-propan-2-ylanilino)phenyl]acetic acid |
|---|---|
| PubChem CID | 153391706 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 2-(3-ethylhexylamino)-2-[3-(4-phenylmethoxy-2-propan-2-ylanilino)phenyl]acetic acid |
| SMILES | CCCC(CC)CCNC(C(=O)O)c1cccc(Nc2ccc(OCc3ccccc3)cc2C(C)C)c1 |
| InChI | InChI=1S/C32H42N2O3/c1-5-11-24(6-2)18-19-33-31(32(35)36)26-14-10-15-27(20-26)34-30-17-16-28(21-29(30)23(3)4)37-22-25-12-8-7-9-13-25/h7-10,12-17,20-21,23-24,31,33-34H,5-6,11,18-19,22H2,1-4H3,(H,35,36) |
| InChIKey | HYSWTXGKLDGDJE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |