C21H21F3N2O4 — CID 153392126
[3-[[2-(4-fluorophenoxy)-1-hydroxyethyl]amino]-1-bicyclo[1.1.1]pentanyl]methyl N-(3,4-difluorophenyl)carbamate (PubChem CID 153392126) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is [3-[[2-(4-fluorophenoxy)-1-hydroxyethyl]amino]-1-bicyclo[1.1.1]pentanyl]methyl N-(3,4-difluorophenyl)carbamate.
| Compound Name | [3-[[2-(4-fluorophenoxy)-1-hydroxyethyl]amino]-1-bicyclo[1.1.1]pentanyl]methyl N-(3,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 153392126 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [3-[[2-(4-fluorophenoxy)-1-hydroxyethyl]amino]-1-bicyclo[1.1.1]pentanyl]methyl N-(3,4-difluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)c(F)c1)OCC12CC(NC(O)COc3ccc(F)cc3)(C1)C2 |
| InChI | InChI=1S/C21H21F3N2O4/c22-13-1-4-15(5-2-13)29-8-18(27)26-21-9-20(10-21,11-21)12-30-19(28)25-14-3-6-16(23)17(24)7-14/h1-7,18,26-27H,8-12H2,(H,25,28) |
| InChIKey | FTHXONNQJFWHIF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|