C22H23NO3 — CID 15339249
benzyl N-[1-(2,4-dimethylfuran-3-yl)ethyl]-N-phenylcarbamate (PubChem CID 15339249) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl N-[1-(2,4-dimethylfuran-3-yl)ethyl]-N-phenylcarbamate.
| Compound Name | benzyl N-[1-(2,4-dimethylfuran-3-yl)ethyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 15339249 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | benzyl N-[1-(2,4-dimethylfuran-3-yl)ethyl]-N-phenylcarbamate |
| SMILES | Cc1coc(C)c1C(C)N(C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-16-14-25-18(3)21(16)17(2)23(20-12-8-5-9-13-20)22(24)26-15-19-10-6-4-7-11-19/h4-14,17H,15H2,1-3H3 |
| InChIKey | PFABXAWQYXWSMA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |