C23H32S3 — CID 153392919
2-(7,7-dibutyl-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)ethynyl-trimethyl-λ4-sulfane (PubChem CID 153392919) has the molecular formula C23H32S3 and a molecular weight of 404.71 g/mol. Its IUPAC name is 2-(7,7-dibutyl-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)ethynyl-trimethyl-λ4-sulfane.
| Compound Name | 2-(7,7-dibutyl-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)ethynyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 153392919 |
| Molecular Formula | C23H32S3 |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(7,7-dibutyl-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)ethynyl-trimethyl-λ4-sulfane |
| SMILES | CCCCC1(CCCC)c2cc(C)sc2-c2sc(C#CS(C)(C)C)cc21 |
| InChI | InChI=1S/C23H32S3/c1-7-9-12-23(13-10-8-2)19-15-17(3)24-21(19)22-20(23)16-18(25-22)11-14-26(4,5)6/h15-16H,7-10,12-13H2,1-6H3 |
| InChIKey | BLRQYSVPZCOADP-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|