C31H46O — CID 142178110
9,9-dibutyl-2,7-ditert-butyl-4,5-dimethylxanthene (PubChem CID 142178110) has the molecular formula C31H46O and a molecular weight of 434.71 g/mol. Its IUPAC name is 9,9-dibutyl-2,7-ditert-butyl-4,5-dimethylxanthene.
| Compound Name | 9,9-dibutyl-2,7-ditert-butyl-4,5-dimethylxanthene |
|---|---|
| PubChem CID | 142178110 |
| Molecular Formula | C31H46O |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | 9,9-dibutyl-2,7-ditert-butyl-4,5-dimethylxanthene |
| SMILES | CCCCC1(CCCC)c2cc(C(C)(C)C)cc(C)c2Oc2c(C)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C31H46O/c1-11-13-15-31(16-14-12-2)25-19-23(29(5,6)7)17-21(3)27(25)32-28-22(4)18-24(20-26(28)31)30(8,9)10/h17-20H,11-16H2,1-10H3 |
| InChIKey | BVCASGFTOALEII-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |