C14H20N2O4 — CID 153393814
(Z)-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-2-(3-oxoprop-1-en-2-yl)but-2-enamide (PubChem CID 153393814) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (Z)-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-2-(3-oxoprop-1-en-2-yl)but-2-enamide.
| Compound Name | (Z)-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-2-(3-oxoprop-1-en-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 153393814 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (Z)-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-2-(3-oxoprop-1-en-2-yl)but-2-enamide |
| SMILES | C=C(C=O)/C(=C/C)C(=O)N(C)C(CCC=O)C(=O)NC |
| InChI | InChI=1S/C14H20N2O4/c1-5-11(10(2)9-18)14(20)16(4)12(7-6-8-17)13(19)15-3/h5,8-9,12H,2,6-7H2,1,3-4H3,(H,15,19)/b11-5- |
| InChIKey | JHAVEIWUCNYMHH-WZUFQYTHSA-N |
| XLogP | 0.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|