C19H27FN4O4 — CID 164592611
(5E,7Z,9E)-10-fluoro-8-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,4-diazacyclododeca-5,7,9-triene-7-carboxamide (PubChem CID 164592611) has the molecular formula C19H27FN4O4 and a molecular weight of 394.45 g/mol. Its IUPAC name is (5E,7Z,9E)-10-fluoro-8-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,4-diazacyclododeca-5,7,9-triene-7-carboxamide.
| Compound Name | (5E,7Z,9E)-10-fluoro-8-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,4-diazacyclododeca-5,7,9-triene-7-carboxamide |
|---|---|
| PubChem CID | 164592611 |
| Molecular Formula | C19H27FN4O4 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (5E,7Z,9E)-10-fluoro-8-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,4-diazacyclododeca-5,7,9-triene-7-carboxamide |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)C1=C(C=O)/C=C(/F)CCNCCN\C=C\1 |
| InChI | InChI=1S/C19H27FN4O4/c1-21-18(27)17(4-3-11-25)24(2)19(28)16-6-8-23-10-9-22-7-5-15(20)12-14(16)13-26/h6,8,11-13,17,22-23H,3-5,7,9-10H2,1-2H3,(H,21,27)/b8-6+,15-12+,16-14- |
| InChIKey | BPPVGBHCENTJRO-VBRVYECXSA-N |
| XLogP | -0.02 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|