C24H23F5N4O4S — CID 153395659
(2,3,4,5,6-pentafluorophenyl) 4-[[5-methyl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]butanoate (PubChem CID 153395659) has the molecular formula C24H23F5N4O4S and a molecular weight of 558.53 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[[5-methyl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[[5-methyl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 153395659 |
| Molecular Formula | C24H23F5N4O4S |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[[5-methyl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]butanoate |
| SMILES | Cc1cnc(NCCCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)nc1Nc1ccccc1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C24H23F5N4O4S/c1-12(2)38(35,36)15-8-5-4-7-14(15)32-23-13(3)11-31-24(33-23)30-10-6-9-16(34)37-22-20(28)18(26)17(25)19(27)21(22)29/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H2,30,31,32,33) |
| InChIKey | OXSQPLPXJXGBLQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|