C26H45N5O9 — CID 153395800
(5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-6-acetamido-2-methylhexanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoyl]amino]-6-amino-6-oxohexanoic acid (PubChem CID 153395800) has the molecular formula C26H45N5O9 and a molecular weight of 571.67 g/mol. Its IUPAC name is (5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-6-acetamido-2-methylhexanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoyl]amino]-6-amino-6-oxohexanoic acid.
| Compound Name | (5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-6-acetamido-2-methylhexanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoyl]amino]-6-amino-6-oxohexanoic acid |
|---|---|
| PubChem CID | 153395800 |
| Molecular Formula | C26H45N5O9 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | (5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-6-acetamido-2-methylhexanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoyl]amino]-6-amino-6-oxohexanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](C)CCCCNC(C)=O)C(=O)N[C@@H](CCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C26H45N5O9/c1-5-15(2)22(26(40)29-18(23(27)37)10-8-11-20(33)34)31-25(39)19(12-13-21(35)36)30-24(38)16(3)9-6-7-14-28-17(4)32/h15-16,18-19,22H,5-14H2,1-4H3,(H2,27,37)(H,28,32)(H,29,40)(H,30,38)(H,31,39)(H,33,34)(H,35,36)/t15?,16-,18-,19-,22-/m0/s1 |
| InChIKey | DDSHAWWWDAGSLS-VHLSBFTISA-N |
| XLogP | 0.03 |
| TPSA | 234.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|