C21H31N3O4 — CID 153398612
1-(2-formamido-3,3-dimethylbutanoyl)-4-hydroxy-N-[1-(4-methylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 153398612) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(2-formamido-3,3-dimethylbutanoyl)-4-hydroxy-N-[1-(4-methylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-formamido-3,3-dimethylbutanoyl)-4-hydroxy-N-[1-(4-methylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153398612 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-(2-formamido-3,3-dimethylbutanoyl)-4-hydroxy-N-[1-(4-methylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)C2CC(O)CN2C(=O)C(NC=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H31N3O4/c1-13-6-8-15(9-7-13)14(2)23-19(27)17-10-16(26)11-24(17)20(28)18(22-12-25)21(3,4)5/h6-9,12,14,16-18,26H,10-11H2,1-5H3,(H,22,25)(H,23,27) |
| InChIKey | TUUIMALZFVBDCR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|