C26H31F4N3O3 — CID 174309024
(2S,4R)-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(2,3,5,6-tetrafluorophenyl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 174309024) has the molecular formula C26H31F4N3O3 and a molecular weight of 509.54 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(2,3,5,6-tetrafluorophenyl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(2,3,5,6-tetrafluorophenyl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174309024 |
| Molecular Formula | C26H31F4N3O3 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(2,3,5,6-tetrafluorophenyl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(-c2c(F)c(F)cc(F)c2F)cc1)C(C)(C)C |
| InChI | InChI=1S/C26H31F4N3O3/c1-13(14-6-8-15(9-7-14)20-21(29)17(27)11-18(28)22(20)30)32-24(35)19-10-16(34)12-33(19)25(36)23(31-5)26(2,3)4/h6-9,11,13,16,19,23,31,34H,10,12H2,1-5H3,(H,32,35)/t13-,16+,19-,23+/m0/s1 |
| InChIKey | SAKFEVCPRINYOW-SWNZKLHASA-N |
| XLogP | 3.68 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|