About ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene
ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene (PubChem CID 153400280) has the molecular formula C23H30N2
and a molecular weight of 334.51 g/mol. Its IUPAC name is ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene.
Molecular Properties
| Compound Name | ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene |
| PubChem CID | 153400280 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene |
| SMILES | CC.CC.Cc1cccc2ccccc12.Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H10.C8H8N2.2C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-6-9-7-4-2-3-5-8(7)10-6;2*1-2/h2-8H,1H3;2-5H,1H3,(H,9,10);2*1-2H3 |
| InChIKey | WLYCDBKZJBKFCS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene?
The IUPAC name of ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene (CID 153400280) is ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene.
What is the SMILES notation for ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene?
The canonical SMILES for ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene is CC.CC.Cc1cccc2ccccc12.Cc1nc2ccccc2[nH]1.
What is the InChIKey of ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene?
The InChIKey is WLYCDBKZJBKFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C8H8N2.2C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-6-9-7-4-2-3-5-8(7)10-6;2*1-2/h2-8H,1H3;2-5H,1H3,(H,9,10);2*1-2H3.
What are the key properties of ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene?
ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene has a molecular weight of 334.51 g/mol, XLogP of 7.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1H-benzimidazole;1-methylnaphthalene is sourced from PubChem (CID 153400280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).