C19H17N3S — CID 39766346
2-(1H-benzimidazol-2-ylmethylsulfanyl)-4,8-dimethylquinoline (PubChem CID 39766346) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4,8-dimethylquinoline.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4,8-dimethylquinoline |
|---|---|
| PubChem CID | 39766346 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4,8-dimethylquinoline |
| SMILES | Cc1cc(SCc2nc3ccccc3[nH]2)nc2c(C)cccc12 |
| InChI | InChI=1S/C19H17N3S/c1-12-6-5-7-14-13(2)10-18(22-19(12)14)23-11-17-20-15-8-3-4-9-16(15)21-17/h3-10H,11H2,1-2H3,(H,20,21) |
| InChIKey | AUXFLLXQNCUSHG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |