C46H41NO6 — CID 153401536
2,6-bis[(2,4-dihydroxyphenyl)methyl]-4-methylphenolate;(4-methoxyphenyl)-triphenylazanium (PubChem CID 153401536) has the molecular formula C46H41NO6 and a molecular weight of 703.84 g/mol. Its IUPAC name is 2,6-bis[(2,4-dihydroxyphenyl)methyl]-4-methylphenolate;(4-methoxyphenyl)-triphenylazanium.
| Compound Name | 2,6-bis[(2,4-dihydroxyphenyl)methyl]-4-methylphenolate;(4-methoxyphenyl)-triphenylazanium |
|---|---|
| PubChem CID | 153401536 |
| Molecular Formula | C46H41NO6 |
| Molecular Weight | 703.84 g/mol |
| Exact Mass | 703.29 |
| IUPAC Name | 2,6-bis[(2,4-dihydroxyphenyl)methyl]-4-methylphenolate;(4-methoxyphenyl)-triphenylazanium |
| SMILES | COc1ccc([N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.Cc1cc(Cc2ccc(O)cc2O)c([O-])c(Cc2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C25H22NO.C21H20O5/c1-27-25-19-17-24(18-20-25)26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-12-6-15(8-13-2-4-17(22)10-19(13)24)21(26)16(7-12)9-14-3-5-18(23)11-20(14)25/h2-20H,1H3;2-7,10-11,22-26H,8-9H2,1H3/q+1;/p-1 |
| InChIKey | WWLVIRCNMNLELF-UHFFFAOYSA-M |
| XLogP | 10.07 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.84 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|