C26H29FN6O5 — CID 153402523
methyl 3-[[2-[3-(4-carbamimidoylphenyl)-2-methyl-1,2-oxazolidin-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 153402523) has the molecular formula C26H29FN6O5 and a molecular weight of 524.55 g/mol. Its IUPAC name is methyl 3-[[2-[3-(4-carbamimidoylphenyl)-2-methyl-1,2-oxazolidin-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-2-methyl-1,2-oxazolidin-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 153402523 |
| Molecular Formula | C26H29FN6O5 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-2-methyl-1,2-oxazolidin-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2CC(CC(=O)NCC(NC(=O)c3[nH]c4ccccc4c3F)C(=O)OC)ON2C)cc1 |
| InChI | InChI=1S/C26H29FN6O5/c1-33-20(14-7-9-15(10-8-14)24(28)29)11-16(38-33)12-21(34)30-13-19(26(36)37-2)32-25(35)23-22(27)17-5-3-4-6-18(17)31-23/h3-10,16,19-20,31H,11-13H2,1-2H3,(H3,28,29)(H,30,34)(H,32,35) |
| InChIKey | UNGNJIWZELABKL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|