C23H40N4O4 — CID 153403819
6-[4-[2-[[(Z)-4,4-dimethylpent-2-en-3-yl]-methylamino]-2-hydroxyethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 153403819) has the molecular formula C23H40N4O4 and a molecular weight of 436.60 g/mol. Its IUPAC name is 6-[4-[2-[[(Z)-4,4-dimethylpent-2-en-3-yl]-methylamino]-2-hydroxyethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[4-[2-[[(Z)-4,4-dimethylpent-2-en-3-yl]-methylamino]-2-hydroxyethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 153403819 |
| Molecular Formula | C23H40N4O4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 6-[4-[2-[[(Z)-4,4-dimethylpent-2-en-3-yl]-methylamino]-2-hydroxyethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | C/C=C(\N(C)C(O)CC1CCN(C(=O)N2CCC3OCC(=O)NC3C2)CC1)C(C)(C)C |
| InChI | InChI=1S/C23H40N4O4/c1-6-19(23(2,3)4)25(5)21(29)13-16-7-10-26(11-8-16)22(30)27-12-9-18-17(14-27)24-20(28)15-31-18/h6,16-18,21,29H,7-15H2,1-5H3,(H,24,28)/b19-6- |
| InChIKey | PVIOIYZZEKIXHC-SWNXQHNESA-N |
| XLogP | 2.00 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|