C14H13FN2O2 — CID 153406253
1-(4-fluorophenyl)-5,6-dimethyl-2-oxopyridine-3-carboxamide (PubChem CID 153406253) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5,6-dimethyl-2-oxopyridine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5,6-dimethyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 153406253 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(4-fluorophenyl)-5,6-dimethyl-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)c(=O)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C14H13FN2O2/c1-8-7-12(13(16)18)14(19)17(9(8)2)11-5-3-10(15)4-6-11/h3-7H,1-2H3,(H2,16,18) |
| InChIKey | ZYEKUSVYKNQDKW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |