C13H12N2O2Se — CID 153406990
3-(4-nitrophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole (PubChem CID 153406990) has the molecular formula C13H12N2O2Se and a molecular weight of 307.21 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole.
| Compound Name | 3-(4-nitrophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole |
|---|---|
| PubChem CID | 153406990 |
| Molecular Formula | C13H12N2O2Se |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 3-(4-nitrophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole |
| SMILES | O=[N+]([O-])c1ccc(-c2n[se]c3c2CCCC3)cc1 |
| InChI | InChI=1S/C13H12N2O2Se/c16-15(17)10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)18-14-13/h5-8H,1-4H2 |
| InChIKey | BTQQGMYZLPSJDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|