C15H10N2O2Se — CID 11484289
4-(4-nitrophenyl)-2-phenyl-1,3-selenazole (PubChem CID 11484289) has the molecular formula C15H10N2O2Se and a molecular weight of 329.22 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-phenyl-1,3-selenazole.
| Compound Name | 4-(4-nitrophenyl)-2-phenyl-1,3-selenazole |
|---|---|
| PubChem CID | 11484289 |
| Molecular Formula | C15H10N2O2Se |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-(4-nitrophenyl)-2-phenyl-1,3-selenazole |
| SMILES | O=[N+]([O-])c1ccc(-c2c[se]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H10N2O2Se/c18-17(19)13-8-6-11(7-9-13)14-10-20-15(16-14)12-4-2-1-3-5-12/h1-10H |
| InChIKey | BSCFQKZLVPEBFZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|