C16H12N2O2Se — CID 11416609
2-benzyl-4-(4-nitrophenyl)-1,3-selenazole (PubChem CID 11416609) has the molecular formula C16H12N2O2Se and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-benzyl-4-(4-nitrophenyl)-1,3-selenazole.
| Compound Name | 2-benzyl-4-(4-nitrophenyl)-1,3-selenazole |
|---|---|
| PubChem CID | 11416609 |
| Molecular Formula | C16H12N2O2Se |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-benzyl-4-(4-nitrophenyl)-1,3-selenazole |
| SMILES | O=[N+]([O-])c1ccc(-c2c[se]c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12N2O2Se/c19-18(20)14-8-6-13(7-9-14)15-11-21-16(17-15)10-12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | NZPJHZHDWUGHDO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|