C19H16F3N3O2 — CID 153408658
(1S,2S,4R,5R,6R,7S)-7-pyrimidin-5-yl-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 153408658) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is (1S,2S,4R,5R,6R,7S)-7-pyrimidin-5-yl-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
| Compound Name | (1S,2S,4R,5R,6R,7S)-7-pyrimidin-5-yl-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
|---|---|
| PubChem CID | 153408658 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (1S,2S,4R,5R,6R,7S)-7-pyrimidin-5-yl-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)[C@H]1[C@@H]2O[C@@H]([C@H]3C[C@H]32)[C@@H]1c1cncnc1 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)10-2-1-3-11(4-10)25-18(26)15-14(9-6-23-8-24-7-9)16-12-5-13(12)17(15)27-16/h1-4,6-8,12-17H,5H2,(H,25,26)/t12-,13+,14+,15+,16-,17+/m0/s1 |
| InChIKey | JNFINACTSIBILG-MHKQFDIHSA-N |
| XLogP | 3.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |