C20H16F4N2O2 — CID 153408710
(1S,2S,4R,5R,6S,7S)-7-(2-fluoro-4-pyridinyl)-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 153408710) has the molecular formula C20H16F4N2O2 and a molecular weight of 392.35 g/mol. Its IUPAC name is (1S,2S,4R,5R,6S,7S)-7-(2-fluoro-4-pyridinyl)-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
| Compound Name | (1S,2S,4R,5R,6S,7S)-7-(2-fluoro-4-pyridinyl)-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
|---|---|
| PubChem CID | 153408710 |
| Molecular Formula | C20H16F4N2O2 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (1S,2S,4R,5R,6S,7S)-7-(2-fluoro-4-pyridinyl)-N-[3-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)[C@@H]1[C@@H]2O[C@@H]([C@H]3C[C@H]32)[C@@H]1c1ccnc(F)c1 |
| InChI | InChI=1S/C20H16F4N2O2/c21-14-6-9(4-5-25-14)15-16(18-13-8-12(13)17(15)28-18)19(27)26-11-3-1-2-10(7-11)20(22,23)24/h1-7,12-13,15-18H,8H2,(H,26,27)/t12-,13+,15+,16-,17-,18+/m0/s1 |
| InChIKey | IWQJNDQBZBLTPA-GZQWEXQLSA-N |
| XLogP | 4.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|