C18H15Cl2FN2O3 — CID 137357674
(1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2-fluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 137357674) has the molecular formula C18H15Cl2FN2O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2-fluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2-fluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 137357674 |
| Molecular Formula | C18H15Cl2FN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2-fluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@@H]1[C@@H](c2ccnc(F)c2)[C@H]2O[C@@H]1C[C@@H]2O |
| InChI | InChI=1S/C18H15Cl2FN2O3/c19-10-2-1-9(6-11(10)20)23-18(25)16-13-7-12(24)17(26-13)15(16)8-3-4-22-14(21)5-8/h1-6,12-13,15-17,24H,7H2,(H,23,25)/t12-,13+,15+,16-,17-/m0/s1 |
| InChIKey | UXFDCSAKNGSXPJ-DRBLLZIRSA-N |
| XLogP | 3.40 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|