C18H14Cl2F2N2O3 — CID 153408671
(1R,2S,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2,5-difluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 153408671) has the molecular formula C18H14Cl2F2N2O3 and a molecular weight of 415.22 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2,5-difluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2,5-difluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 153408671 |
| Molecular Formula | C18H14Cl2F2N2O3 |
| Molecular Weight | 415.22 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (1R,2S,3S,4R,5S)-N-(3,4-dichlorophenyl)-3-(2,5-difluoro-4-pyridinyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@H]1[C@@H](c2cc(F)ncc2F)[C@H]2O[C@@H]1C[C@@H]2O |
| InChI | InChI=1S/C18H14Cl2F2N2O3/c19-9-2-1-7(3-10(9)20)24-18(26)16-13-5-12(25)17(27-13)15(16)8-4-14(22)23-6-11(8)21/h1-4,6,12-13,15-17,25H,5H2,(H,24,26)/t12-,13+,15+,16+,17-/m0/s1 |
| InChIKey | RDVMKHXPPDPIKM-CNLQAYEWSA-N |
| XLogP | 3.54 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|