C18H14Cl2FN3O2 — CID 153408686
(1S,2S,4R,5R,6S,7S)-N-(3,4-dichlorophenyl)-7-(2-fluoropyrimidin-5-yl)-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 153408686) has the molecular formula C18H14Cl2FN3O2 and a molecular weight of 394.23 g/mol. Its IUPAC name is (1S,2S,4R,5R,6S,7S)-N-(3,4-dichlorophenyl)-7-(2-fluoropyrimidin-5-yl)-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
| Compound Name | (1S,2S,4R,5R,6S,7S)-N-(3,4-dichlorophenyl)-7-(2-fluoropyrimidin-5-yl)-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
|---|---|
| PubChem CID | 153408686 |
| Molecular Formula | C18H14Cl2FN3O2 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (1S,2S,4R,5R,6S,7S)-N-(3,4-dichlorophenyl)-7-(2-fluoropyrimidin-5-yl)-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@@H]1[C@@H]2O[C@@H]([C@H]3C[C@H]32)[C@@H]1c1cnc(F)nc1 |
| InChI | InChI=1S/C18H14Cl2FN3O2/c19-11-2-1-8(3-12(11)20)24-17(25)14-13(7-5-22-18(21)23-6-7)15-9-4-10(9)16(14)26-15/h1-3,5-6,9-10,13-16H,4H2,(H,24,25)/t9-,10+,13+,14-,15-,16+/m0/s1 |
| InChIKey | PAMCBZYOLJEHQH-JMKGMWJGSA-N |
| XLogP | 3.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |