C17H16Cl2N4O3 — CID 152553350
(1R,2S,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 152553350) has the molecular formula C17H16Cl2N4O3 and a molecular weight of 395.25 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 152553350 |
| Molecular Formula | C17H16Cl2N4O3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (1R,2S,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Nc1ncc([C@H]2[C@H]3O[C@H](C[C@@H]3O)[C@H]2C(=O)Nc2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C17H16Cl2N4O3/c18-9-2-1-8(3-10(9)19)23-16(25)14-12-4-11(24)15(26-12)13(14)7-5-21-17(20)22-6-7/h1-3,5-6,11-15,24H,4H2,(H,23,25)(H2,20,21,22)/t11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | YNYLCCPXWLITAW-JARUQAPTSA-N |
| XLogP | 2.24 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |