C18H17Cl2N3O3 — CID 150416819
(1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-hydroxy-3-(2-methylpyrimidin-4-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 150416819) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-hydroxy-3-(2-methylpyrimidin-4-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-hydroxy-3-(2-methylpyrimidin-4-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 150416819 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-hydroxy-3-(2-methylpyrimidin-4-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1nccc([C@H]2[C@H]3O[C@H](C[C@@H]3O)[C@@H]2C(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-8-21-5-4-12(22-8)15-16(14-7-13(24)17(15)26-14)18(25)23-9-2-3-10(19)11(20)6-9/h2-6,13-17,24H,7H2,1H3,(H,23,25)/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | HGYNFTFIMWUSCZ-BIVLZKPYSA-N |
| XLogP | 2.96 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |