C20H20Cl2N2O3 — CID 151457872
(1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-methoxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 151457872) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-methoxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-methoxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 151457872 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (1R,2R,3S,4R,5S)-N-(3,4-dichlorophenyl)-5-methoxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CO[C@H]1C[C@H]2O[C@@H]1[C@H](c1ccnc(C)c1)[C@H]2C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-10-7-11(5-6-23-10)17-18(15-9-16(26-2)19(17)27-15)20(25)24-12-3-4-13(21)14(22)8-12/h3-8,15-19H,9H2,1-2H3,(H,24,25)/t15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | PHVLXANSOALFMD-LFDJNIOPSA-N |
| XLogP | 4.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |