C19H18Cl2N2O4 — CID 164517670
(1R,2R,3S,4R,5S,6R)-N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 164517670) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S,6R)-N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S,6R)-N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 164517670 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (1R,2R,3S,4R,5S,6R)-N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1cc([C@H]2[C@H]3O[C@@H]([C@H](O)[C@@H]3O)[C@@H]2C(=O)Nc2ccc(Cl)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C19H18Cl2N2O4/c1-8-6-9(4-5-22-8)13-14(18-16(25)15(24)17(13)27-18)19(26)23-10-2-3-11(20)12(21)7-10/h2-7,13-18,24-25H,1H3,(H,23,26)/t13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | XIDNRTOVJNXRHJ-OOOWVJFSSA-N |
| XLogP | 2.54 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |