C17H15Cl2FN4O2 — CID 151254314
(1R,2R,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-fluoro-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 151254314) has the molecular formula C17H15Cl2FN4O2 and a molecular weight of 397.24 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-fluoro-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-fluoro-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 151254314 |
| Molecular Formula | C17H15Cl2FN4O2 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (1R,2R,3S,4R,5S)-3-(2-aminopyrimidin-5-yl)-N-(3,4-dichlorophenyl)-5-fluoro-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Nc1ncc([C@H]2[C@H]3O[C@H](C[C@@H]3F)[C@@H]2C(=O)Nc2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C17H15Cl2FN4O2/c18-9-2-1-8(3-10(9)19)24-16(25)14-12-4-11(20)15(26-12)13(14)7-5-22-17(21)23-6-7/h1-3,5-6,11-15H,4H2,(H,24,25)(H2,21,22,23)/t11-,12+,13+,14-,15-/m0/s1 |
| InChIKey | NSZSIRFRRVIVLZ-QRTUWBSPSA-N |
| XLogP | 3.21 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |