C16H17Cl2FN2 — CID 153408997
2-chloro-4-N-[1-(4-chloro-3-fluorophenyl)-2-methylpropan-2-yl]benzene-1,4-diamine (PubChem CID 153408997) has the molecular formula C16H17Cl2FN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 2-chloro-4-N-[1-(4-chloro-3-fluorophenyl)-2-methylpropan-2-yl]benzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[1-(4-chloro-3-fluorophenyl)-2-methylpropan-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 153408997 |
| Molecular Formula | C16H17Cl2FN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-chloro-4-N-[1-(4-chloro-3-fluorophenyl)-2-methylpropan-2-yl]benzene-1,4-diamine |
| SMILES | CC(C)(Cc1ccc(Cl)c(F)c1)Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2FN2/c1-16(2,9-10-3-5-12(17)14(19)7-10)21-11-4-6-15(20)13(18)8-11/h3-8,21H,9,20H2,1-2H3 |
| InChIKey | WQQLCVCDBRBXST-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|