C27H21N5O2 — CID 153411554
4,15-dimethyl-9-[3-[(4-methyl-2-pyridinyl)oxy]phenoxy]-2,3,5,14-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene (PubChem CID 153411554) has the molecular formula C27H21N5O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4,15-dimethyl-9-[3-[(4-methyl-2-pyridinyl)oxy]phenoxy]-2,3,5,14-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene.
| Compound Name | 4,15-dimethyl-9-[3-[(4-methyl-2-pyridinyl)oxy]phenoxy]-2,3,5,14-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 153411554 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4,15-dimethyl-9-[3-[(4-methyl-2-pyridinyl)oxy]phenoxy]-2,3,5,14-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
| SMILES | Cc1ccnc(Oc2cccc(Oc3ccc4c(c3)c3nc(C)nn3c3ccc(C)nc43)c2)c1 |
| InChI | InChI=1S/C27H21N5O2/c1-16-11-12-28-25(13-16)34-20-6-4-5-19(14-20)33-21-8-9-22-23(15-21)27-30-18(3)31-32(27)24-10-7-17(2)29-26(22)24/h4-15H,1-3H3 |
| InChIKey | YLFUIIHABLCOET-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|