C47H56N4O — CID 153417195
9-(4-butyl-2-pyridinyl)-2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]-5-propan-2-ylphenoxy]carbazole (PubChem CID 153417195) has the molecular formula C47H56N4O and a molecular weight of 692.99 g/mol. Its IUPAC name is 9-(4-butyl-2-pyridinyl)-2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]-5-propan-2-ylphenoxy]carbazole.
| Compound Name | 9-(4-butyl-2-pyridinyl)-2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]-5-propan-2-ylphenoxy]carbazole |
|---|---|
| PubChem CID | 153417195 |
| Molecular Formula | C47H56N4O |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.45 |
| IUPAC Name | 9-(4-butyl-2-pyridinyl)-2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]-5-propan-2-ylphenoxy]carbazole |
| SMILES | CCCCc1ccnc(-n2c3ccccc3c3ccc(Oc4cc(C(C)C)cc(-n5nc(CC)c(C6C(CC)=CCC[C@@H]6CC)c5CC)c4)cc32)c1 |
| InChI | InChI=1S/C47H56N4O/c1-8-13-17-32-24-25-48-45(26-32)50-43-21-15-14-20-39(43)40-23-22-37(30-44(40)50)52-38-28-35(31(6)7)27-36(29-38)51-42(12-5)47(41(11-4)49-51)46-33(9-2)18-16-19-34(46)10-3/h14-15,18,20-31,34,46H,8-13,16-17,19H2,1-7H3/t34-,46?/m0/s1 |
| InChIKey | WLOSNHSEBJXFMY-RANAGLCVSA-N |
| XLogP | 12.99 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|