About N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine
N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine (PubChem CID 153419194) has the molecular formula C24H22N4O
and a molecular weight of 382.47 g/mol. Its IUPAC name is N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine.
Molecular Properties
| Compound Name | N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine |
| PubChem CID | 153419194 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine |
| SMILES | c1ccc(Oc2cccc(N(CNCc3ccccn3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H22N4O/c1-3-11-21(12-4-1)28(19-25-18-20-10-7-8-17-26-20)23-15-9-16-24(27-23)29-22-13-5-2-6-14-22/h1-17,25H,18-19H2 |
| InChIKey | UBCKSDSJZWIFSM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine?
The IUPAC name of N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine (CID 153419194) is N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine.
What is the SMILES notation for N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine?
The canonical SMILES for N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine is c1ccc(Oc2cccc(N(CNCc3ccccn3)c3ccccc3)n2)cc1.
What is the InChIKey of N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine?
The InChIKey is UBCKSDSJZWIFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O/c1-3-11-21(12-4-1)28(19-25-18-20-10-7-8-17-26-20)23-15-9-16-24(27-23)29-22-13-5-2-6-14-22/h1-17,25H,18-19H2.
What are the key properties of N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine?
N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine has a molecular weight of 382.47 g/mol, XLogP of 5.15, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-phenoxy-2-pyridinyl)-N'-phenyl-N-(pyridin-2-ylmethyl)methanediamine is sourced from PubChem (CID 153419194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).