About N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine
N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine (PubChem CID 153419219) has the molecular formula C24H22N4
and a molecular weight of 366.47 g/mol. Its IUPAC name is N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine.
Molecular Properties
| Compound Name | N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine |
| PubChem CID | 153419219 |
| Molecular Formula | C24H22N4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine |
| SMILES | c1ccc(-c2cccc(N(CNCc3ccccn3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H22N4/c1-3-10-20(11-4-1)23-15-9-16-24(27-23)28(22-13-5-2-6-14-22)19-25-18-21-12-7-8-17-26-21/h1-17,25H,18-19H2 |
| InChIKey | XTDXCOIJZSXXJQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine?
The IUPAC name of N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine (CID 153419219) is N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine.
What is the SMILES notation for N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine?
The canonical SMILES for N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine is c1ccc(-c2cccc(N(CNCc3ccccn3)c3ccccc3)n2)cc1.
What is the InChIKey of N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine?
The InChIKey is XTDXCOIJZSXXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4/c1-3-10-20(11-4-1)23-15-9-16-24(27-23)28(22-13-5-2-6-14-22)19-25-18-21-12-7-8-17-26-21/h1-17,25H,18-19H2.
What are the key properties of N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine?
N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine has a molecular weight of 366.47 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-phenyl-N'-(6-phenyl-2-pyridinyl)-N-(pyridin-2-ylmethyl)methanediamine is sourced from PubChem (CID 153419219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).