C16H22INO — CID 153419726
9-(3-iodophenyl)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonane (PubChem CID 153419726) has the molecular formula C16H22INO and a molecular weight of 371.26 g/mol. Its IUPAC name is 9-(3-iodophenyl)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonane.
| Compound Name | 9-(3-iodophenyl)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 153419726 |
| Molecular Formula | C16H22INO |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 9-(3-iodophenyl)-9-methoxy-3-methyl-3-azabicyclo[3.3.1]nonane |
| SMILES | COC1(c2cccc(I)c2)C2CCCC1CN(C)C2 |
| InChI | InChI=1S/C16H22INO/c1-18-10-13-6-3-7-14(11-18)16(13,19-2)12-5-4-8-15(17)9-12/h4-5,8-9,13-14H,3,6-7,10-11H2,1-2H3 |
| InChIKey | BSDGVQQICKOFEP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|