C19H32F2N4O3 — CID 153424108
N-[(1R)-5-[5-(difluoromethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-(hydroxymethyl)piperidine-2-carboxamide (PubChem CID 153424108) has the molecular formula C19H32F2N4O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[(1R)-5-[5-(difluoromethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-(hydroxymethyl)piperidine-2-carboxamide.
| Compound Name | N-[(1R)-5-[5-(difluoromethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-(hydroxymethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 153424108 |
| Molecular Formula | C19H32F2N4O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-[(1R)-5-[5-(difluoromethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-(hydroxymethyl)piperidine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCC2CC(C3NOC(C(F)F)N3)CCC21)C1CC(CO)CCN1 |
| InChI | InChI=1S/C19H32F2N4O3/c20-16(21)19-24-17(25-28-19)12-1-3-13-11(8-12)2-4-14(13)23-18(27)15-7-10(9-26)5-6-22-15/h10-17,19,22,24-26H,1-9H2,(H,23,27)/t10?,11?,12?,13?,14-,15?,17?,19?/m1/s1 |
| InChIKey | GBMFIEJLWPTMGD-KSQQNEBGSA-N |
| XLogP | 0.70 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |