C20H34F2N4O2 — CID 153424156
2-(difluoromethyl)-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]piperidine-4-carboxamide (PubChem CID 153424156) has the molecular formula C20H34F2N4O2 and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]piperidine-4-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 153424156 |
| Molecular Formula | C20H34F2N4O2 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-(difluoromethyl)-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]piperidine-4-carboxamide |
| SMILES | CCC1NC(C2CCC3C(CC[C@H]3NC(=O)C3CCNC(C(F)F)C3)C2)NO1 |
| InChI | InChI=1S/C20H34F2N4O2/c1-2-17-25-19(26-28-17)12-3-5-14-11(9-12)4-6-15(14)24-20(27)13-7-8-23-16(10-13)18(21)22/h11-19,23,25-26H,2-10H2,1H3,(H,24,27)/t11?,12?,13?,14?,15-,16?,17?,19?/m1/s1 |
| InChIKey | UKZKPNOQGSCVFN-YVJAZRLQSA-N |
| XLogP | 2.12 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |