C10H10BBrN2O — CID 153424183
CID 153424183 (PubChem CID 153424183) has the molecular formula C10H10BBrN2O and a molecular weight of 264.92 g/mol.
| Compound Name | CID 153424183 |
|---|---|
| PubChem CID | 153424183 |
| Molecular Formula | C10H10BBrN2O |
| Molecular Weight | 264.92 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)NC1CCc2cc(Br)cnc21 |
| InChI | InChI=1S/C10H10BBrN2O/c11-4-9(15)14-8-2-1-6-3-7(12)5-13-10(6)8/h3,5,8H,1-2,4H2,(H,14,15) |
| InChIKey | OIHHWBJUEVBYEO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.92 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|