C26H31N3O2 — CID 15342486
1-(cyclohexylmethyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea (PubChem CID 15342486) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea.
| Compound Name | 1-(cyclohexylmethyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea |
|---|---|
| PubChem CID | 15342486 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea |
| SMILES | Cc1cc2c(-c3ccccc3)c(NC(=O)NCC3CCCCC3)n(C)c(=O)c2cc1C |
| InChI | InChI=1S/C26H31N3O2/c1-17-14-21-22(15-18(17)2)25(30)29(3)24(23(21)20-12-8-5-9-13-20)28-26(31)27-16-19-10-6-4-7-11-19/h5,8-9,12-15,19H,4,6-7,10-11,16H2,1-3H3,(H2,27,28,31) |
| InChIKey | NLEIJYHPRBWSCP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |