C6H14N2 — CID 153425171
(5R)-1,5-dimethyldiazinane (PubChem CID 153425171) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (5R)-1,5-dimethyldiazinane.
| Compound Name | (5R)-1,5-dimethyldiazinane |
|---|---|
| PubChem CID | 153425171 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (5R)-1,5-dimethyldiazinane |
| SMILES | C[C@@H]1CCNN(C)C1 |
| InChI | InChI=1S/C6H14N2/c1-6-3-4-7-8(2)5-6/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | TZLSVSFFDPHNGD-ZCFIWIBFSA-N |
| XLogP | 0.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |