C40H47FO9 — CID 153425328
[5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-hydroxyethoxy)-4-(2-oxopropanoyloxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 153425328) has the molecular formula C40H47FO9 and a molecular weight of 690.80 g/mol. Its IUPAC name is [5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-hydroxyethoxy)-4-(2-oxopropanoyloxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-hydroxyethoxy)-4-(2-oxopropanoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153425328 |
| Molecular Formula | C40H47FO9 |
| Molecular Weight | 690.80 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | [5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-hydroxyethoxy)-4-(2-oxopropanoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(-c2ccc(C3CCC(CCCCC)CC3)cc2F)cc(-c2ccc(OC(=O)C(C)=O)c(OCCO)c2)c1OCCO |
| InChI | InChI=1S/C40H47FO9/c1-5-6-7-8-27-9-11-28(12-10-27)29-13-15-32(34(41)22-29)31-21-33(38(48-20-18-43)37(24-31)50-39(45)25(2)3)30-14-16-35(49-40(46)26(4)44)36(23-30)47-19-17-42/h13-16,21-24,27-28,42-43H,2,5-12,17-20H2,1,3-4H3 |
| InChIKey | LSHRLMDESZKMOD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.80 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|