C49H57FO13 — CID 155156904
2-O-[2-[(2-ethoxy-2-oxoacetyl)oxymethyl]-3-[4-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenoxy]propyl] 1-O-ethyl oxalate (PubChem CID 155156904) has the molecular formula C49H57FO13 and a molecular weight of 872.98 g/mol. Its IUPAC name is 2-O-[2-[(2-ethoxy-2-oxoacetyl)oxymethyl]-3-[4-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenoxy]propyl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[2-[(2-ethoxy-2-oxoacetyl)oxymethyl]-3-[4-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenoxy]propyl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 155156904 |
| Molecular Formula | C49H57FO13 |
| Molecular Weight | 872.98 g/mol |
| Exact Mass | 872.38 |
| IUPAC Name | 2-O-[2-[(2-ethoxy-2-oxoacetyl)oxymethyl]-3-[4-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenoxy]propyl] 1-O-ethyl oxalate |
| SMILES | C=C(C)C(=O)Oc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3F)cc2)c(OC(=O)C(=C)C)cc1OCC(COC(=O)C(=O)OCC)COC(=O)C(=O)OCC |
| InChI | InChI=1S/C49H57FO13/c1-8-11-12-13-32-14-16-34(17-15-32)37-22-23-38(40(50)24-37)35-18-20-36(21-19-35)39-25-43(63-45(52)31(6)7)42(26-41(39)62-44(51)30(4)5)59-27-33(28-60-48(55)46(53)57-9-2)29-61-49(56)47(54)58-10-3/h18-26,32-34H,4,6,8-17,27-29H2,1-3,5,7H3 |
| InChIKey | ZZFIUAKQQXLFGN-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.98 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|